CAS 1909336-90-8 appears in our catalog under these names: 4-((2,5-Difluorophenyl)methyl)-1H-imidazole hydrochloride, 95%, 4-((2,5-Difluorophenyl)methyl)-1H-imidazole hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-[(2,5-difluorophenyl)methyl]-1H-imidazole;hydrochloride (CAS 1909336-90-8) is a chemical compound with the molecular formula C10H9ClF2N2 and a molecular weight of 230.64 g/mol. IUPAC name: 5-[(2,5-difluorophenyl)methyl]-1H-imidazole;hydrochloride. InChIKey: HMSBVZGKAYIJNR-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2N2 |
|---|---|
| Molecular weight | 230.64 g/mol |
| IUPAC name | 5-[(2,5-difluorophenyl)methyl]-1H-imidazole;hydrochloride |
| InChIKey | HMSBVZGKAYIJNR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CC2=CN=CN2)F.Cl |
Computed by PubChem (NCBI)