CAS 2219407-32-4 is the registry number for 4-((2,4-Difluorophenyl)methyl)-1H-pyrazole hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[(2,4-difluorophenyl)methyl]-1H-pyrazole;hydrochloride (CAS 2219407-32-4) is a chemical compound with the molecular formula C10H9ClF2N2 and a molecular weight of 230.64 g/mol. IUPAC name: 4-[(2,4-difluorophenyl)methyl]-1H-pyrazole;hydrochloride. InChIKey: MJLIVJNLCODVAW-UHFFFAOYSA-N.
| Molecular formula | C10H9ClF2N2 |
|---|---|
| Molecular weight | 230.64 g/mol |
| IUPAC name | 4-[(2,4-difluorophenyl)methyl]-1H-pyrazole;hydrochloride |
| InChIKey | MJLIVJNLCODVAW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)CC2=CNN=C2.Cl |
Computed by PubChem (NCBI)