Products 1909336-95-3

CAS 1909336-95-3 is the registry number for 2-(Hydroxymethyl)-1,3-thiazole-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

2-(hydroxymethyl)-1,3-thiazole-4-carboxylic acid;hydrochloride (CAS 1909336-95-3) is a chemical compound with the molecular formula C5H6ClNO3S and a molecular weight of 195.62 g/mol. IUPAC name: 2-(hydroxymethyl)-1,3-thiazole-4-carboxylic acid;hydrochloride. InChIKey: YKALDGLTNMBKDD-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6ClNO3S
Molecular weight195.62 g/mol
IUPAC name2-(hydroxymethyl)-1,3-thiazole-4-carboxylic acid;hydrochloride
InChIKeyYKALDGLTNMBKDD-UHFFFAOYSA-N
SMILESC1=C(N=C(S1)CO)C(=O)O.Cl

Computed by PubChem (NCBI)