CAS 80466-79-1 appears in our catalog under these names: 3,5–Dimethylisoxazole–4–sulfonyl chloride, 3,5-Dimethylisoxazole-4-sulfonyl chloride, 97%, 3,5-Dimethylisoxazole-4-sulfonyl chloride, 98%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 10g.
3,5-dimethyl-1,2-oxazole-4-sulfonyl chloride (CAS 80466-79-1) is a chemical compound with the molecular formula C5H6ClNO3S and a molecular weight of 195.62 g/mol. IUPAC name: 3,5-dimethyl-1,2-oxazole-4-sulfonyl chloride. InChIKey: GZLPFEYTAAXJCP-UHFFFAOYSA-N.
| Molecular formula | C5H6ClNO3S |
|---|---|
| Molecular weight | 195.62 g/mol |
| IUPAC name | 3,5-dimethyl-1,2-oxazole-4-sulfonyl chloride |
| InChIKey | GZLPFEYTAAXJCP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)