CAS 1909347-79-0 appears in our catalog under these names: 6-Amino-7-fluoro-2H,3H,4H-pyrido(3,2-b)(1,4)oxazin-3-one, 95%, 6-Amino-7-fluoro-2H,3H,4H-pyrido(3,2-b)(1,4)oxazin-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-amino-7-fluoro-4H-pyrido[3,2-b][1,4]oxazin-3-one (CAS 1909347-79-0) is a chemical compound with the molecular formula C7H6FN3O2 and a molecular weight of 183.14 g/mol. IUPAC name: 6-amino-7-fluoro-4H-pyrido[3,2-b][1,4]oxazin-3-one. InChIKey: WPDBTFMEWIMMPK-UHFFFAOYSA-N.
| Molecular formula | C7H6FN3O2 |
|---|---|
| Molecular weight | 183.14 g/mol |
| IUPAC name | 6-amino-7-fluoro-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| InChIKey | WPDBTFMEWIMMPK-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=NC(=C(C=C2O1)F)N |
Computed by PubChem (NCBI)