CAS 6214-58-0 is the registry number for 3-(5-Fluoro-2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)propanenitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(5-fluoro-2,4-dioxopyrimidin-1-yl)propanenitrile (CAS 6214-58-0) is a chemical compound with the molecular formula C7H6FN3O2 and a molecular weight of 183.14 g/mol. IUPAC name: 3-(5-fluoro-2,4-dioxopyrimidin-1-yl)propanenitrile. InChIKey: RVOUYNBKEJHLNU-UHFFFAOYSA-N.
| Molecular formula | C7H6FN3O2 |
|---|---|
| Molecular weight | 183.14 g/mol |
| IUPAC name | 3-(5-fluoro-2,4-dioxopyrimidin-1-yl)propanenitrile |
| InChIKey | RVOUYNBKEJHLNU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1CCC#N)F |
Computed by PubChem (NCBI)