Products 1910051-05-6
CAS 1910051-05-6 is the registry number for 6-(2,6-Dichloro-3,5-dimethoxyphenyl)-1H-pyrazolo[3,4-b]pyridin-3-amine, 96%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
6-(2,6-dichloro-3,5-dimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridin-3-amine (CAS 1910051-05-6) is a chemical compound with the molecular formula C14H12Cl2N4O2 and a molecular weight of 339.2 g/mol. IUPAC name: 6-(2,6-dichloro-3,5-dimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridin-3-amine. InChIKey: FFDYSBSXORVDCP-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2N4O2 |
|---|---|
| Molecular weight | 339.2 g/mol |
| IUPAC name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridin-3-amine |
| InChIKey | FFDYSBSXORVDCP-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1Cl)C2=NC3=NNC(=C3C=C2)N)Cl)OC |
Computed by PubChem (NCBI)