CAS 1912-63-6 appears in our catalog under these names: Abiraterone Impurity 23, Androsta-3,5-dien-17-one. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
(8R,9S,10R,13S,14S)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one (CAS 1912-63-6) is a chemical compound with the molecular formula C19H26O and a molecular weight of 270.4 g/mol. IUPAC name: (8R,9S,10R,13S,14S)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one. InChIKey: NINLAYUXSUKKHW-QAGGRKNESA-N.
| Molecular formula | C19H26O |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | (8R,9S,10R,13S,14S)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-one |
| InChIKey | NINLAYUXSUKKHW-QAGGRKNESA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CC=C4[C@@]3(CCC=C4)C |
Computed by PubChem (NCBI)