Products 4075-07-4
CAS 4075-07-4 appears in our catalog under these names: 4,16-Androstadien-3-one, 250 mg, Androstadienone, 4,16-Androstadien-3-one, 50 mg, 4,16-Androstadien-3-one, 100 mg, 4,16-Androstadien-3-one, 500 mg. Offered by: Roth, TRC. Available pack sizes: 250mg, 50mg, 5mg, 100mg, 500mg.
(8S,9S,10R,13R,14S)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (CAS 4075-07-4) is a chemical compound with the molecular formula C19H26O and a molecular weight of 270.4 g/mol. IUPAC name: (8S,9S,10R,13R,14S)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one. InChIKey: HNDHDMOSWUAEAW-VMXHOPILSA-N.
| Molecular formula | C19H26O |
|---|---|
| Molecular weight | 270.4 g/mol |
| IUPAC name | (8S,9S,10R,13R,14S)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| InChIKey | HNDHDMOSWUAEAW-VMXHOPILSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC=C2)CCC4=CC(=O)CC[C@]34C |
Computed by PubChem (NCBI)