CAS 19123-62-7 is the registry number for L-gamma-Glutamyl-3-(1-propenylsulfinyl)-L-alanine. Offered by: TRC. Available pack sizes: 1g.
(2S)-2-amino-5-[[(1R)-1-carboxy-2-[(E)-prop-1-enyl]sulfinylethyl]amino]-5-oxopentanoic acid (CAS 19123-62-7) is a chemical compound with the molecular formula C11H18N2O6S and a molecular weight of 306.34 g/mol. IUPAC name: (2S)-2-amino-5-[[(1R)-1-carboxy-2-[(E)-prop-1-enyl]sulfinylethyl]amino]-5-oxopentanoic acid. InChIKey: LMNDKWXDMBGGAL-DGLWNAOESA-N.
| Molecular formula | C11H18N2O6S |
|---|---|
| Molecular weight | 306.34 g/mol |
| IUPAC name | (2S)-2-amino-5-[[(1R)-1-carboxy-2-[(E)-prop-1-enyl]sulfinylethyl]amino]-5-oxopentanoic acid |
| InChIKey | LMNDKWXDMBGGAL-DGLWNAOESA-N |
| SMILES | C/C=C/S(=O)C[C@@H](C(=O)O)NC(=O)CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)