CAS 64051-18-9 appears in our catalog under these names: Neostigmine Impurity 14 Metilsulfate, N,N,N-Trimethyl-3-((aminocarbonyl)oxy)-Benzenaminium Methyl Sulfate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(3-carbamoyloxyphenyl)-trimethylazanium;methyl sulfate (CAS 64051-18-9) is a chemical compound with the molecular formula C11H18N2O6S and a molecular weight of 306.34 g/mol. IUPAC name: (3-carbamoyloxyphenyl)-trimethylazanium;methyl sulfate. InChIKey: ZABUYIINIKPQQB-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O6S |
|---|---|
| Molecular weight | 306.34 g/mol |
| IUPAC name | (3-carbamoyloxyphenyl)-trimethylazanium;methyl sulfate |
| InChIKey | ZABUYIINIKPQQB-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C1=CC(=CC=C1)OC(=O)N.COS(=O)(=O)[O-] |
Computed by PubChem (NCBI)