CAS 191353-21-6 appears in our catalog under these names: (aza((2-fluorophenyl)amino)methylene)methane-1,1-dicarbonitrile, (aza((2-fluorophenyl)amino)methylene)methane-1,1-dicarbonitrile, 95%, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 1000mg, 500mg, 1g, 5g, 25g.
2-[(2-fluorophenyl)hydrazinylidene]propanedinitrile (CAS 191353-21-6) is a chemical compound with the molecular formula C9H5FN4 and a molecular weight of 188.16 g/mol. IUPAC name: 2-[(2-fluorophenyl)hydrazinylidene]propanedinitrile. InChIKey: SDNFYXHVPYJZNC-UHFFFAOYSA-N.
| Molecular formula | C9H5FN4 |
|---|---|
| Molecular weight | 188.16 g/mol |
| IUPAC name | 2-[(2-fluorophenyl)hydrazinylidene]propanedinitrile |
| InChIKey | SDNFYXHVPYJZNC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NN=C(C#N)C#N)F |
Computed by PubChem (NCBI)