CAS 19136-40-4 appears in our catalog under these names: 6-Amino-1-[3-(trifluoromethyl)phenyl]pyrimidine-2,4(1h,3h)-dione, 95%, 6-Amino-1-(3-(trifluoromethyl)phenyl)pyrimidine-2,4(1H,3H)-dione, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
6-amino-1-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-dione (CAS 19136-40-4) is a chemical compound with the molecular formula C11H8F3N3O2 and a molecular weight of 271.19 g/mol. IUPAC name: 6-amino-1-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-dione. InChIKey: NZJQTMUNEBDVBO-UHFFFAOYSA-N.
| Molecular formula | C11H8F3N3O2 |
|---|---|
| Molecular weight | 271.19 g/mol |
| IUPAC name | 6-amino-1-[3-(trifluoromethyl)phenyl]pyrimidine-2,4-dione |
| InChIKey | NZJQTMUNEBDVBO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N2C(=CC(=O)NC2=O)N)C(F)(F)F |
Computed by PubChem (NCBI)