CAS 2197054-33-2 is the registry number for 1-(Pyridin-2-ylmethyl)-3-(trifluoromethyl)-1h-pyrazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
1-(pyridin-2-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid (CAS 2197054-33-2) is a chemical compound with the molecular formula C11H8F3N3O2 and a molecular weight of 271.19 g/mol. IUPAC name: 1-(pyridin-2-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid. InChIKey: IOGLBDVNCWUKBN-UHFFFAOYSA-N.
| Molecular formula | C11H8F3N3O2 |
|---|---|
| Molecular weight | 271.19 g/mol |
| IUPAC name | 1-(pyridin-2-ylmethyl)-3-(trifluoromethyl)pyrazole-5-carboxylic acid |
| InChIKey | IOGLBDVNCWUKBN-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CN2C(=CC(=N2)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)