Products 1914057-93-4
CAS 1914057-93-4 is the registry number for 1-(3-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethanone, 97%, 97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
1-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone (CAS 1914057-93-4) is a chemical compound with the molecular formula C15H21BO3 and a molecular weight of 260.14 g/mol. IUPAC name: 1-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone. InChIKey: GCQYPZJDCUYTTG-UHFFFAOYSA-N.
| Molecular formula | C15H21BO3 |
|---|---|
| Molecular weight | 260.14 g/mol |
| IUPAC name | 1-[3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethanone |
| InChIKey | GCQYPZJDCUYTTG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)C(=O)C)C |
Computed by PubChem (NCBI)