CAS 1914148-55-2 appears in our catalog under these names: 3–Methylpyridine–2–sulfonic acid hydrate, 3-Methylpyridine-2-sulfonic acid hydrate, 95%. Offered by: GLPBio, AmBeed. Available pack sizes: 100mg, 250mg, 5g.
3-methylpyridine-2-sulfonic acid;hydrate (CAS 1914148-55-2) is a chemical compound with the molecular formula C6H9NO4S and a molecular weight of 191.21 g/mol. IUPAC name: 3-methylpyridine-2-sulfonic acid;hydrate. InChIKey: RSQIMDKJHKOOQW-UHFFFAOYSA-N.
| Molecular formula | C6H9NO4S |
|---|---|
| Molecular weight | 191.21 g/mol |
| IUPAC name | 3-methylpyridine-2-sulfonic acid;hydrate |
| InChIKey | RSQIMDKJHKOOQW-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CC=C1)S(=O)(=O)O.O |
Computed by PubChem (NCBI)