Products 2417009-90-4
CAS 2417009-90-4 is the registry number for 3-Sulfamoylbicyclo[1.1.1]pentane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-sulfamoylbicyclo[1.1.1]pentane-1-carboxylic acid (CAS 2417009-90-4) is a chemical compound with the molecular formula C6H9NO4S and a molecular weight of 191.21 g/mol. IUPAC name: 3-sulfamoylbicyclo[1.1.1]pentane-1-carboxylic acid. InChIKey: XTDHEHPIUUXVMZ-UHFFFAOYSA-N.
| Molecular formula | C6H9NO4S |
|---|---|
| Molecular weight | 191.21 g/mol |
| IUPAC name | 3-sulfamoylbicyclo[1.1.1]pentane-1-carboxylic acid |
| InChIKey | XTDHEHPIUUXVMZ-UHFFFAOYSA-N |
| SMILES | C1C2(CC1(C2)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)