CAS 191544-78-2 is the registry number for (3S,5R)-rel-1-tert-Butyl 3-Methyl 5-(((Benzyloxy)carbonyl)amino)piperidine-1,3-dicarboxylate. Offered by: TRC. Available pack sizes: 1g.
1-O-tert-butyl 3-O-methyl (3S,5R)-5-(phenylmethoxycarbonylamino)piperidine-1,3-dicarboxylate (CAS 191544-78-2) is a chemical compound with the molecular formula C20H28N2O6 and a molecular weight of 392.4 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3S,5R)-5-(phenylmethoxycarbonylamino)piperidine-1,3-dicarboxylate. InChIKey: NLZDJMITIXIHKC-JKSUJKDBSA-N.
| Molecular formula | C20H28N2O6 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3S,5R)-5-(phenylmethoxycarbonylamino)piperidine-1,3-dicarboxylate |
| InChIKey | NLZDJMITIXIHKC-JKSUJKDBSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H](C1)NC(=O)OCC2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)