Products 2349395-76-0

CAS 2349395-76-0 is the registry number for 1-Benzyl 4-(tert-butyl) 2-methyl (2R,5R)-5-methylpiperazine-1,2,4-tricarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-O-benzyl 4-O-tert-butyl 2-O-methyl (2R,5R)-5-methylpiperazine-1,2,4-tricarboxylate (CAS 2349395-76-0) is a chemical compound with the molecular formula C20H28N2O6 and a molecular weight of 392.4 g/mol. IUPAC name: 1-O-benzyl 4-O-tert-butyl 2-O-methyl (2R,5R)-5-methylpiperazine-1,2,4-tricarboxylate. InChIKey: OPLMMWUGTOXMPZ-GDBMZVCRSA-N.

Identity
Molecular formulaC20H28N2O6
Molecular weight392.4 g/mol
IUPAC name1-O-benzyl 4-O-tert-butyl 2-O-methyl (2R,5R)-5-methylpiperazine-1,2,4-tricarboxylate
InChIKeyOPLMMWUGTOXMPZ-GDBMZVCRSA-N
SMILESC[C@@H]1CN([C@H](CN1C(=O)OC(C)(C)C)C(=O)OC)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)