CAS 191656-33-4 appears in our catalog under these names: D4-4-Chloroaniline, 4-Chloroaniline-d4, >95% (HPLC), 4-Chlorobenzen-2,3,5,6-D4-amine, 4-Chloroaniline-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, D4-4-Chloroaniline, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards, TRC, MedChemExpress, CDN. Available pack sizes: 1x10mg, 100mg, 10mg, 5mg, 5 mg, 100 mg, 10 mg, 0,25g.
4-chloro-2,3,5,6-tetradeuterioaniline (CAS 191656-33-4) is a chemical compound with the molecular formula C6H6ClN and a molecular weight of 131.59 g/mol. IUPAC name: 4-chloro-2,3,5,6-tetradeuterioaniline. InChIKey: QSNSCYSYFYORTR-RHQRLBAQSA-N.
| Molecular formula | C6H6ClN |
|---|---|
| Molecular weight | 131.59 g/mol |
| IUPAC name | 4-chloro-2,3,5,6-tetradeuterioaniline |
| InChIKey | QSNSCYSYFYORTR-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])Cl)[2H] |
Computed by PubChem (NCBI)