Products 89059-39-2
CAS 89059-39-2 appears in our catalog under these names: 4-Chlorophenylamine-13C6, >95% (HPLC), 4-Chloroaniline 13C6. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 10mg, 1mg.
4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine (CAS 89059-39-2) is a chemical compound with the molecular formula C6H6ClN and a molecular weight of 133.53 g/mol. IUPAC name: 4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine. InChIKey: QSNSCYSYFYORTR-IDEBNGHGSA-N.
| Molecular formula | C6H6ClN |
|---|---|
| Molecular weight | 133.53 g/mol |
| IUPAC name | 4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine |
| InChIKey | QSNSCYSYFYORTR-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1N)Cl |
Computed by PubChem (NCBI)