Products 191739-36-3

CAS 191739-36-3 appears in our catalog under these names: 1,4-Bis(benzyloxycarbonyl)piperazine-2-carboxylic acid, 95%, 1,4-Bis(benzyloxycarbonyl)piperazine-2-carboxylic acid, 98%, 1,4-Bis(benzyloxycarbonyl)piperazine-2-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

1,4-bis(phenylmethoxycarbonyl)piperazine-2-carboxylic acid (CAS 191739-36-3) is a chemical compound with the molecular formula C21H22N2O6 and a molecular weight of 398.4 g/mol. IUPAC name: 1,4-bis(phenylmethoxycarbonyl)piperazine-2-carboxylic acid. InChIKey: WXQFHIXVEGWTFS-UHFFFAOYSA-N.

Identity
Molecular formulaC21H22N2O6
Molecular weight398.4 g/mol
IUPAC name1,4-bis(phenylmethoxycarbonyl)piperazine-2-carboxylic acid
InChIKeyWXQFHIXVEGWTFS-UHFFFAOYSA-N
SMILESC1CN(C(CN1C(=O)OCC2=CC=CC=C2)C(=O)O)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)