CAS 544478-19-5 appears in our catalog under these names: MRS1845, 98%, MRS1845/ 99.69% (existing batch purity), MRS 1845, MRS 1845, MRS1845, 97%, 97%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 100mg, 1g, 1mg, 10mg, 25mg, 50mg, 5mg.
5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1-prop-2-ynyl-4H-pyridine-3,5-dicarboxylate (CAS 544478-19-5) is a chemical compound with the molecular formula C21H22N2O6 and a molecular weight of 398.4 g/mol. IUPAC name: 5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1-prop-2-ynyl-4H-pyridine-3,5-dicarboxylate. InChIKey: BITHABUTZRAUGT-UHFFFAOYSA-N.
| Molecular formula | C21H22N2O6 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | 5-O-ethyl 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1-prop-2-ynyl-4H-pyridine-3,5-dicarboxylate |
| InChIKey | BITHABUTZRAUGT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(C(=C(C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC)C)CC#C)C |
Computed by PubChem (NCBI)