CAS 191919-02-5 appears in our catalog under these names: 8-iso-13,14-dihydro-15-keto Prostaglandin F2α, 8–iso–13,14–dihydro–15–keto Prostaglandin F2α. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 1mg, 100ug, 500ug, 100μg, 50μg, 500μg, Get quote.
(Z)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]hept-5-enoic acid (CAS 191919-02-5) is a chemical compound with the molecular formula C20H34O5 and a molecular weight of 354.5 g/mol. IUPAC name: (Z)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]hept-5-enoic acid. InChIKey: VKTIONYPMSCHQI-JPRPWBOBSA-N.
| Molecular formula | C20H34O5 |
|---|---|
| Molecular weight | 354.5 g/mol |
| IUPAC name | (Z)-7-[(1S,2R,3R,5S)-3,5-dihydroxy-2-(3-oxooctyl)cyclopentyl]hept-5-enoic acid |
| InChIKey | VKTIONYPMSCHQI-JPRPWBOBSA-N |
| SMILES | CCCCCC(=O)CC[C@H]1[C@@H](C[C@@H]([C@H]1C/C=C\CCCC(=O)O)O)O |
Computed by PubChem (NCBI)