CAS 19216-68-3 is the registry number for Alfuzosin hydrochloride EP Impurity F hydrochloride. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 250mg, 100mg.
6,7-dimethoxy-2-N,2-N-dimethylquinazoline-2,4-diamine;hydrochloride (CAS 19216-68-3) is a chemical compound with the molecular formula C12H17ClN4O2 and a molecular weight of 284.74 g/mol. IUPAC name: 6,7-dimethoxy-2-N,2-N-dimethylquinazoline-2,4-diamine;hydrochloride. InChIKey: ZPYIZKJUGLCUHO-UHFFFAOYSA-N.
| Molecular formula | C12H17ClN4O2 |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | 6,7-dimethoxy-2-N,2-N-dimethylquinazoline-2,4-diamine;hydrochloride |
| InChIKey | ZPYIZKJUGLCUHO-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC2=CC(=C(C=C2C(=N1)N)OC)OC.Cl |
Computed by PubChem (NCBI)