Products 19216-68-3

CAS 19216-68-3 is the registry number for Alfuzosin hydrochloride EP Impurity F hydrochloride. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg, 250mg, 100mg.

Structural formula: {0} (CAS {1})

6,7-dimethoxy-2-N,2-N-dimethylquinazoline-2,4-diamine;hydrochloride (CAS 19216-68-3) is a chemical compound with the molecular formula C12H17ClN4O2 and a molecular weight of 284.74 g/mol. IUPAC name: 6,7-dimethoxy-2-N,2-N-dimethylquinazoline-2,4-diamine;hydrochloride. InChIKey: ZPYIZKJUGLCUHO-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17ClN4O2
Molecular weight284.74 g/mol
IUPAC name6,7-dimethoxy-2-N,2-N-dimethylquinazoline-2,4-diamine;hydrochloride
InChIKeyZPYIZKJUGLCUHO-UHFFFAOYSA-N
SMILESCN(C)C1=NC2=CC(=C(C=C2C(=N1)N)OC)OC.Cl

Computed by PubChem (NCBI)