Products 848369-63-1

CAS 848369-63-1 is the registry number for 3-Butyl-8-(chloromethyl)-7-ethyl-3,7-dihydro-1h-purine-2,6-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-butyl-8-(chloromethyl)-7-ethylpurine-2,6-dione (CAS 848369-63-1) is a chemical compound with the molecular formula C12H17ClN4O2 and a molecular weight of 284.74 g/mol. IUPAC name: 3-butyl-8-(chloromethyl)-7-ethylpurine-2,6-dione. InChIKey: MUBJNOSPWBBXHZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17ClN4O2
Molecular weight284.74 g/mol
IUPAC name3-butyl-8-(chloromethyl)-7-ethylpurine-2,6-dione
InChIKeyMUBJNOSPWBBXHZ-UHFFFAOYSA-N
SMILESCCCCN1C2=C(C(=O)NC1=O)N(C(=N2)CCl)CC

Computed by PubChem (NCBI)