CAS 19227-14-6 appears in our catalog under these names: (E)–4–Bromo–N'–hydroxybenzimidamide, (E)-4-Bromo-N'-hydroxybenzimidamide, 4-Bromo-N-hydroxybenzimidamide 98%, 4-Bromobenzamidoxime, 98%. Offered by: GLPBio, Biosynth, Ambeed, Fluorochem. Available pack sizes: 25g, 5g, 0,25g, 2,5g, 1g, 100g.
4-bromo-N'-hydroxybenzenecarboximidamide (CAS 19227-14-6) is a chemical compound with the molecular formula C7H7BrN2O and a molecular weight of 215.05 g/mol. IUPAC name: 4-bromo-N'-hydroxybenzenecarboximidamide. InChIKey: KCHIZOZPSSURRB-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O |
|---|---|
| Molecular weight | 215.05 g/mol |
| IUPAC name | 4-bromo-N'-hydroxybenzenecarboximidamide |
| InChIKey | KCHIZOZPSSURRB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1/C(=N/O)/N)Br |
Computed by PubChem (NCBI)