CAS 69113-23-1 appears in our catalog under these names: 4-Bromo-N'-hydroxybenzenecarboximidamide, 98%, 4-Bromo-N'-hydroxybenzimidamide, 98%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 100g, 5g, 25g, 1g, on request.
4-bromo-N'-hydroxybenzenecarboximidamide (CAS 69113-23-1) is a chemical compound with the molecular formula C7H7BrN2O and a molecular weight of 215.05 g/mol. IUPAC name: 4-bromo-N'-hydroxybenzenecarboximidamide. InChIKey: KCHIZOZPSSURRB-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O |
|---|---|
| Molecular weight | 215.05 g/mol |
| IUPAC name | 4-bromo-N'-hydroxybenzenecarboximidamide |
| InChIKey | KCHIZOZPSSURRB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1/C(=N/O)/N)Br |
Computed by PubChem (NCBI)