Products 192318-04-0
CAS 192318-04-0 appears in our catalog under these names: (S)–4–Cyclohexyl–2–(pyridin–2–yl)–4，5–dihydrooxazole, (S)-4-Cyclohexyl-2-(pyridin-2-yl)-4,5-dihydrooxazole, 98% 99%ee, 98% 99%ee, (S)-4-Cyclohexyl-2-(pyridin-2-yl)-4,5-dihydrooxazole, 98% 99%ee, (S)-4-Cyclohexyl-2-(pyridin-2-yl)-4,5-dihydrooxazole 98% 99%ee. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(4S)-4-cyclohexyl-2-pyridin-2-yl-4,5-dihydro-1,3-oxazole (CAS 192318-04-0) is a chemical compound with the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. IUPAC name: (4S)-4-cyclohexyl-2-pyridin-2-yl-4,5-dihydro-1,3-oxazole. InChIKey: UDMCHJFTOGLLHO-CYBMUJFWSA-N.
| Molecular formula | C14H18N2O |
|---|---|
| Molecular weight | 230.31 g/mol |
| IUPAC name | (4S)-4-cyclohexyl-2-pyridin-2-yl-4,5-dihydro-1,3-oxazole |
| InChIKey | UDMCHJFTOGLLHO-CYBMUJFWSA-N |
| SMILES | C1CCC(CC1)[C@H]2COC(=N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)