CAS 1923237-09-5 is the registry number for Diethyl 1-[2-(4-fluorophenyl)-2-oxoethyl]-1h-imidazole-2,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Diethyl 1-[2-(4-fluorophenyl)-2-oxoethyl]imidazole-2,4-dicarboxylate (CAS 1923237-09-5) is a chemical compound with the molecular formula C17H17FN2O5 and a molecular weight of 348.32 g/mol. IUPAC name: diethyl 1-[2-(4-fluorophenyl)-2-oxoethyl]imidazole-2,4-dicarboxylate. InChIKey: XNAUSCAAQARKMN-UHFFFAOYSA-N.
| Molecular formula | C17H17FN2O5 |
|---|---|
| Molecular weight | 348.32 g/mol |
| IUPAC name | diethyl 1-[2-(4-fluorophenyl)-2-oxoethyl]imidazole-2,4-dicarboxylate |
| InChIKey | XNAUSCAAQARKMN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(C(=N1)C(=O)OCC)CC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)