CAS 931399-19-8 appears in our catalog under these names: GSK360A, >95% (HPLC), GSK360A, GSK 360A, GSK360A, 99.90%. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 1mg, 5 mg, 10mM/1mL.
2-[[1-(2-cyclopropylethyl)-6-fluoro-4-hydroxy-2-oxoquinoline-3-carbonyl]amino]acetic acid (CAS 931399-19-8) is a chemical compound with the molecular formula C17H17FN2O5 and a molecular weight of 348.32 g/mol. IUPAC name: 2-[[1-(2-cyclopropylethyl)-6-fluoro-4-hydroxy-2-oxoquinoline-3-carbonyl]amino]acetic acid. InChIKey: TYHRZQVUPPODPT-UHFFFAOYSA-N.
| Molecular formula | C17H17FN2O5 |
|---|---|
| Molecular weight | 348.32 g/mol |
| IUPAC name | 2-[[1-(2-cyclopropylethyl)-6-fluoro-4-hydroxy-2-oxoquinoline-3-carbonyl]amino]acetic acid |
| InChIKey | TYHRZQVUPPODPT-UHFFFAOYSA-N |
| SMILES | C1CC1CCN2C3=C(C=C(C=C3)F)C(=C(C2=O)C(=O)NCC(=O)O)O |
Computed by PubChem (NCBI)