Products 1924671-90-8

CAS 1924671-90-8 is the registry number for Rosiglitazone Related Compound 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1,3,4-trimethylcyclopent-3-ene-1-carboxylic acid (CAS 1924671-90-8) is a chemical compound with the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. IUPAC name: 1,3,4-trimethylcyclopent-3-ene-1-carboxylic acid. InChIKey: UAASJARSTBQIHO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14O2
Molecular weight154.21 g/mol
IUPAC name1,3,4-trimethylcyclopent-3-ene-1-carboxylic acid
InChIKeyUAASJARSTBQIHO-UHFFFAOYSA-N
SMILESCC1=C(CC(C1)(C)C(=O)O)C

Computed by PubChem (NCBI)