CAS 192512-42-8 is the registry number for Methyl 3,5-dichloro-4-ethoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
Methyl 3,5-dichloro-4-ethoxybenzoate (CAS 192512-42-8) is a chemical compound with the molecular formula C10H10Cl2O3 and a molecular weight of 249.09 g/mol. IUPAC name: methyl 3,5-dichloro-4-ethoxybenzoate. InChIKey: FJFFMHPWJYLMOU-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O3 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | methyl 3,5-dichloro-4-ethoxybenzoate |
| InChIKey | FJFFMHPWJYLMOU-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1Cl)C(=O)OC)Cl |
Computed by PubChem (NCBI)