CAS 41490-09-9 appears in our catalog under these names: 3,5-Dichloro-4-propoxybenzoic acid, 95%, 3,5-Dichloro-4-propoxybenzoic acid, 95+%, 3,5-Dichloro-4-propoxybenzoic acid, 95%, 95%, 3,5-Dichloro-4-propoxybenzoic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 25g, 5g, 1g, 100mg, 250mg.
3,5-dichloro-4-propoxybenzoic acid (CAS 41490-09-9) is a chemical compound with the molecular formula C10H10Cl2O3 and a molecular weight of 249.09 g/mol. IUPAC name: 3,5-dichloro-4-propoxybenzoic acid. InChIKey: IMSKTSQBDRLEBN-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O3 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 3,5-dichloro-4-propoxybenzoic acid |
| InChIKey | IMSKTSQBDRLEBN-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)