CAS 1926163-87-2 appears in our catalog under these names: Fmoc-ala(alpha-cyclopropyl)-oh, 95%, Fmoc–α–cyclopropyl–Ala–OH. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
(2S)-2-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1926163-87-2) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (2S)-2-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: SBWCIRABWAINIK-NRFANRHFSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2S)-2-cyclopropyl-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | SBWCIRABWAINIK-NRFANRHFSA-N |
| SMILES | C[C@](C1CC1)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)