CAS 1926222-30-1 is the registry number for VU0477886. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-amino-N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]pyridine-2-carboxamide (CAS 1926222-30-1) is a chemical compound with the molecular formula C20H13ClN4O3 and a molecular weight of 392.8 g/mol. IUPAC name: 3-amino-N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]pyridine-2-carboxamide. InChIKey: XBKGMJNNALFSAJ-UHFFFAOYSA-N.
| Molecular formula | C20H13ClN4O3 |
|---|---|
| Molecular weight | 392.8 g/mol |
| IUPAC name | 3-amino-N-[3-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]pyridine-2-carboxamide |
| InChIKey | XBKGMJNNALFSAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=C(C=C(C=C3)NC(=O)C4=C(C=CC=N4)N)Cl |
Computed by PubChem (NCBI)