Products 2271348-89-9
CAS 2271348-89-9 is the registry number for SMARCA2/4-ligand-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[2-[4-[(2-chloro-4-pyridinyl)carbamoylamino]-2-pyridinyl]ethynyl]benzoic acid (CAS 2271348-89-9) is a chemical compound with the molecular formula C20H13ClN4O3 and a molecular weight of 392.8 g/mol. IUPAC name: 3-[2-[4-[(2-chloro-4-pyridinyl)carbamoylamino]-2-pyridinyl]ethynyl]benzoic acid. InChIKey: ATBXCKLXXDLBAC-UHFFFAOYSA-N.
| Molecular formula | C20H13ClN4O3 |
|---|---|
| Molecular weight | 392.8 g/mol |
| IUPAC name | 3-[2-[4-[(2-chloro-4-pyridinyl)carbamoylamino]-2-pyridinyl]ethynyl]benzoic acid |
| InChIKey | ATBXCKLXXDLBAC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C#CC2=NC=CC(=C2)NC(=O)NC3=CC(=NC=C3)Cl |
Computed by PubChem (NCBI)