CAS 360045-10-9 is the registry number for 1-(3,5-Dimethylphenyl)-7-methylindole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
1-(3,5-dimethylphenyl)-7-methylindole (CAS 360045-10-9) is a chemical compound with the molecular formula C17H17N and a molecular weight of 235.32 g/mol. IUPAC name: 1-(3,5-dimethylphenyl)-7-methylindole. InChIKey: OWZFPLIJLWVQGQ-UHFFFAOYSA-N.
| Molecular formula | C17H17N |
|---|---|
| Molecular weight | 235.32 g/mol |
| IUPAC name | 1-(3,5-dimethylphenyl)-7-methylindole |
| InChIKey | OWZFPLIJLWVQGQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C=CN2C3=CC(=CC(=C3)C)C |
Computed by PubChem (NCBI)