CAS 192717-48-9 appears in our catalog under these names: 3-(Pyridin-3-yl)cyclohexanone, 95%, 3-(Pyridin-3-yl)cyclohexanone, 95+%, 3-(Pyridin-3-yl)cyclohexan-1-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 250mg, 5g, 1g, 0,5g, 50mg.
3-pyridin-3-ylcyclohexan-1-one (CAS 192717-48-9) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 3-pyridin-3-ylcyclohexan-1-one. InChIKey: YVMAOAQUIBACCC-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 3-pyridin-3-ylcyclohexan-1-one |
| InChIKey | YVMAOAQUIBACCC-UHFFFAOYSA-N |
| SMILES | C1CC(CC(=O)C1)C2=CN=CC=C2 |
Computed by PubChem (NCBI)