CAS 192725-50-1 appears in our catalog under these names: (S)-Tetrahydro-Alpha-(1-methylethyl)-2-oxo-1(2H)-pyrimidineacetic Acid, >95% (HPLC), (2S)-3-Methyl-2-(2-oxotetrahydropyrimidin-1(2H)-yl)butanoic Acid, (2S)–(1–Tetrahydropyramid–2–one)–3–methylbutanoic acid, (S)-3-Methyl-2-(2-oxotetrahydropyrimidin-1(2H)-yl)butanoic acid, 97%, 97%, (S)-3-Methyl-2-(2-oxotetrahydropyrimidin-1(2H)-yl)butanoic acid, 97%. Offered by: TRC, Mikromol, GLPBio, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 25mg, 25g, 5g, 100g.
(2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoic acid (CAS 192725-50-1) is a chemical compound with the molecular formula C9H16N2O3 and a molecular weight of 200.23 g/mol. IUPAC name: (2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoic acid. InChIKey: AFGBRTKUTJQHIP-ZETCQYMHSA-N.
| Molecular formula | C9H16N2O3 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | (2S)-3-methyl-2-(2-oxo-1,3-diazinan-1-yl)butanoic acid |
| InChIKey | AFGBRTKUTJQHIP-ZETCQYMHSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)N1CCCNC1=O |
Computed by PubChem (NCBI)