Products 1927969-23-0
CAS 1927969-23-0 appears in our catalog under these names: S-(trifluoromethyl) 4-chlorobenzothioate, 97%, S-(Trifluoromethyl) 4-chlorobenzenecarbothioate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
S-(trifluoromethyl) 4-chlorobenzenecarbothioate (CAS 1927969-23-0) is a chemical compound with the molecular formula C8H4ClF3OS and a molecular weight of 240.63 g/mol. IUPAC name: S-(trifluoromethyl) 4-chlorobenzenecarbothioate. InChIKey: GYDGLKMEGPOALV-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3OS |
|---|---|
| Molecular weight | 240.63 g/mol |
| IUPAC name | S-(trifluoromethyl) 4-chlorobenzenecarbothioate |
| InChIKey | GYDGLKMEGPOALV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)SC(F)(F)F)Cl |
Computed by PubChem (NCBI)
Synonyms:
S-(trifluoromethyl) 4-chlorobenzothioate