CAS 330-14-3 appears in our catalog under these names: 4-(Trifluoromethylthio)benzoyl chloride, 95%, 4-(Trifluoromethylthio)benzoyl Chloride, 4–(Trifluoromethylthio)benzoyl chloride, 4-(Trifluoromethylthio)benzoyl Chloride, >98.0%(GC)(T), 4-(Trifluoromethylthio)benzoyl chloride 97%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 25g, 5g, 1g, 2,5g, 100g, 250mg.
4-(trifluoromethylsulfanyl)benzoyl chloride (CAS 330-14-3) is a chemical compound with the molecular formula C8H4ClF3OS and a molecular weight of 240.63 g/mol. IUPAC name: 4-(trifluoromethylsulfanyl)benzoyl chloride. InChIKey: BCMFTOCCLOAGBP-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3OS |
|---|---|
| Molecular weight | 240.63 g/mol |
| IUPAC name | 4-(trifluoromethylsulfanyl)benzoyl chloride |
| InChIKey | BCMFTOCCLOAGBP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)Cl)SC(F)(F)F |
Computed by PubChem (NCBI)