CAS 192803-37-5 appears in our catalog under these names: 3-(tert-Butyl)-2,5-dihydroxybenzaldehyde, 98%, 3–(tert–Butyl)–2,5–dihydroxybenzaldehyde, 3-(tert-Butyl)-2,5-dihydroxybenzaldehyde, 98%, 98%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 25g, 1g, 10g, 100g, 100mg, 5g.
3-tert-butyl-2,5-dihydroxybenzaldehyde (CAS 192803-37-5) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 3-tert-butyl-2,5-dihydroxybenzaldehyde. InChIKey: TZZLDYZCZGLIJA-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 3-tert-butyl-2,5-dihydroxybenzaldehyde |
| InChIKey | TZZLDYZCZGLIJA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C=O)O |
Computed by PubChem (NCBI)