CAS 192820-78-3 appears in our catalog under these names: ES 936, ES 936, ES 936, 98.66%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 500mg, 10mg, 50mg, 50 mg, 5 mg, 10 mg, 25 mg.
5-methoxy-1,2-dimethyl-3-[(4-nitrophenoxy)methyl]indole-4,7-dione (CAS 192820-78-3) is a chemical compound with the molecular formula C18H16N2O6 and a molecular weight of 356.3 g/mol. IUPAC name: 5-methoxy-1,2-dimethyl-3-[(4-nitrophenoxy)methyl]indole-4,7-dione. InChIKey: IBLWSLZYYZHSRG-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O6 |
|---|---|
| Molecular weight | 356.3 g/mol |
| IUPAC name | 5-methoxy-1,2-dimethyl-3-[(4-nitrophenoxy)methyl]indole-4,7-dione |
| InChIKey | IBLWSLZYYZHSRG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C)C(=O)C=C(C2=O)OC)COC3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)