CAS 54867-56-0 appears in our catalog under these names: Bufrolin, >95% (HPLC), Bufrolin, 98%, Bufrolin, ≥95%, ≥95%, Bufrolin, 95.16%. Offered by: TRC, AmBeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 1mg, 1 mg.
6-butyl-4,10-dioxo-1,7-dihydro-1,7-phenanthroline-2,8-dicarboxylic acid (CAS 54867-56-0) is a chemical compound with the molecular formula C18H16N2O6 and a molecular weight of 356.3 g/mol. IUPAC name: 6-butyl-4,10-dioxo-1,7-dihydro-1,7-phenanthroline-2,8-dicarboxylic acid. InChIKey: BQVIONBNDNFCCP-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O6 |
|---|---|
| Molecular weight | 356.3 g/mol |
| IUPAC name | 6-butyl-4,10-dioxo-1,7-dihydro-1,7-phenanthroline-2,8-dicarboxylic acid |
| InChIKey | BQVIONBNDNFCCP-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC2=C(C3=C1NC(=CC3=O)C(=O)O)NC(=CC2=O)C(=O)O |
Computed by PubChem (NCBI)