CAS 1928712-34-8 is the registry number for (S)-Phenethyl 2-hydroxypropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-phenylethyl (2S)-2-hydroxypropanoate (CAS 1928712-34-8) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 2-phenylethyl (2S)-2-hydroxypropanoate. InChIKey: IYXFDAOFSCZADY-VIFPVBQESA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-phenylethyl (2S)-2-hydroxypropanoate |
| InChIKey | IYXFDAOFSCZADY-VIFPVBQESA-N |
| SMILES | C[C@@H](C(=O)OCCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)