CAS 192997-17-4 appears in our catalog under these names: 1-(2-Fluorobenzyl)-1h-indole-3-carbaldehyde, 95%, 1-(2-Fluoro-benzyl)-1 H -indole-3-carbaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
1-[(2-fluorophenyl)methyl]indole-3-carbaldehyde (CAS 192997-17-4) is a chemical compound with the molecular formula C16H12FNO and a molecular weight of 253.27 g/mol. IUPAC name: 1-[(2-fluorophenyl)methyl]indole-3-carbaldehyde. InChIKey: BIXFNGJGIDLTPF-UHFFFAOYSA-N.
| Molecular formula | C16H12FNO |
|---|---|
| Molecular weight | 253.27 g/mol |
| IUPAC name | 1-[(2-fluorophenyl)methyl]indole-3-carbaldehyde |
| InChIKey | BIXFNGJGIDLTPF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=C(C3=CC=CC=C32)C=O)F |
Computed by PubChem (NCBI)