Products 26206-00-8
CAS 26206-00-8 appears in our catalog under these names: 2-Methyl-3-(4'-fluorobenzoyl)indole, 95%, 2-Methyl-3-(4'-fluorobenzoyl)indole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100mg, 500mg.
(4-fluorophenyl)-(2-methyl-1H-indol-3-yl)methanone (CAS 26206-00-8) is a chemical compound with the molecular formula C16H12FNO and a molecular weight of 253.27 g/mol. IUPAC name: (4-fluorophenyl)-(2-methyl-1H-indol-3-yl)methanone. InChIKey: YLQSMBXRBZJCHM-UHFFFAOYSA-N.
| Molecular formula | C16H12FNO |
|---|---|
| Molecular weight | 253.27 g/mol |
| IUPAC name | (4-fluorophenyl)-(2-methyl-1H-indol-3-yl)methanone |
| InChIKey | YLQSMBXRBZJCHM-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1)C(=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)