CAS 1931877-15-4 is the registry number for D-Sorbitol-d2. Offered by: MedChemExpress. Available pack sizes: 100 mg, 250 mg, 500 mg.
(2S,3R,4R,5R)-1,1-dideuteriohexane-1,2,3,4,5,6-hexol (CAS 1931877-15-4) is a chemical compound with the molecular formula C6H14O6 and a molecular weight of 184.18 g/mol. IUPAC name: (2S,3R,4R,5R)-1,1-dideuteriohexane-1,2,3,4,5,6-hexol. InChIKey: FBPFZTCFMRRESA-SIAWFSHJSA-N.
| Molecular formula | C6H14O6 |
|---|---|
| Molecular weight | 184.18 g/mol |
| IUPAC name | (2S,3R,4R,5R)-1,1-dideuteriohexane-1,2,3,4,5,6-hexol |
| InChIKey | FBPFZTCFMRRESA-SIAWFSHJSA-N |
| SMILES | [2H]C([2H])([C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)O |
Computed by PubChem (NCBI)