Products 1932004-78-8
CAS 1932004-78-8 is the registry number for (1R)-1-(3-bromophenyl)-2-fluoroethan-1-amine, 97%. Offered by: Chemat. Available pack sizes: 1g.
(1R)-1-(3-bromophenyl)-2-fluoroethanamine (CAS 1932004-78-8) is a chemical compound with the molecular formula C8H9BrFN and a molecular weight of 218.07 g/mol. IUPAC name: (1R)-1-(3-bromophenyl)-2-fluoroethanamine. InChIKey: LQLVPMKRMRYDGN-QMMMGPOBSA-N.
| Molecular formula | C8H9BrFN |
|---|---|
| Molecular weight | 218.07 g/mol |
| IUPAC name | (1R)-1-(3-bromophenyl)-2-fluoroethanamine |
| InChIKey | LQLVPMKRMRYDGN-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@H](CF)N |
Computed by PubChem (NCBI)